RefMet Compound Details
MW structure | 37407 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | L-Xylulose | |
Systematic name | (3R,4S)-1,3,4,5-tetrahydroxypentan-2-one | |
SMILES | C([C@@H]([C@H](C(=O)CO)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 150.052825 (neutral) |
Table of KEGG reactions in human pathways involving L-Xylulose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01904 | Xylitol + NADP+ <=> L-Xylulose + NADPH + H+ | Xylitol:NADP+ 4-oxidoreductase (L-xylulose-forming) |
Table of KEGG human pathways containing L-Xylulose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 1 |