RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0161551 | |
---|---|---|
RefMet name | LPC 16:1(9Z)/0:0 | |
Synonyms | PubChem Synonyms | |
Exact mass | 493.3168 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C24H48NO7P | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 14996 (Download molfile/View MW Metabolite Database details) | |
InChI | ||
InChIKey | LFUDDCMNKWEORN-ZXEGGCGDSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | CCCCCC/C=CCCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Glycerophospholipids | |
Main Class | Glycerophosphocholines | |
Sub Class | LPC (Lysophosphatidylcholines) | |
Distribution of LPC 16:1(9Z)/0:0 in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting LPC 16:1(9Z)/0:0 | |
External Links | ||
Pubchem CID | 24779461 | |
LIPID MAPS | LMGP01050022 | |
ChEBI ID | 73851 | |
KEGG ID | C01194 | |
HMDB ID | HMDB0010383 | |
Chemspider ID | 24766525 | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving LPC 16:1(9Z)/0:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01802 | CDP-diacylglycerol + myo-Inositol <=> CMP + 1-Phosphatidyl-D-myo-inositol | CDP-diacylglycerol:myo-inositol 3-phosphatidyltransferase |
R03332 | 1-Phosphatidyl-D-myo-inositol + H2O <=> Inositol 1-phosphate + 1,2-Diacyl-sn-glycerol | 1-Phosphatidyl-D-myo-inositol inositolphosphohydrolase |
R03361 | ATP + 1-Phosphatidyl-D-myo-inositol <=> ADP + 1-Phosphatidyl-1D-myo-inositol 4-phosphate | ATP:1-Phosphatidyl-1D-myo-inositol 4-phosphotransferase |
R03362 | ATP + 1-Phosphatidyl-D-myo-inositol <=> ADP + 1-Phosphatidyl-1D-myo-inositol 3-phosphate | ATP:1-phosphatidyl-1D-myo-inositol 3-phosphotransferase |
R03363 | 1-Phosphatidyl-1D-myo-inositol 3-phosphate + H2O <=> 1-Phosphatidyl-D-myo-inositol + Orthophosphate | 1-Phosphatidyl-1D-myo-inositol 3-phosphate 3-phosphohydrolase |
R05916 | UDP-N-acetyl-D-glucosamine + 1-Phosphatidyl-D-myo-inositol <=> UDP + G00143 | UDP-N-acetyl-D-glucosamine + 1-Phosphatidyl-D-myo-inositol <=> UDP + G00143 |
R09034 | Acyl-CoA + 1-Acylglycerophosphoinositol <=> CoA + 1-Phosphatidyl-D-myo-inositol | acyl-CoA:1-acyl-sn-glycero-3-phosphoinositol O-acyltransferase |
R10951 | ATP + 1-Phosphatidyl-D-myo-inositol <=> ADP + 1-Phosphatidyl-1D-myo-inositol 5-phosphate | ATP:1-phosphatidyl-1D-myo-inositol 5-phosphotransferase |
R11680 | 1-Phosphatidyl-1D-myo-inositol 4-phosphate + H2O <=> 1-Phosphatidyl-D-myo-inositol + Orthophosphate | 1-Phosphatidyl-1D-myo-inositol 4-phosphate + H2O <=> 1-Phosphatidyl-D-myo-inositol + Orthophosphate |
Table of KEGG human pathways containing LPC 16:1(9Z)/0:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa04070 | Phosphatidylinositol signaling system | 7 |
hsa00562 | Inositol phosphate metabolism | 5 |
hsa00564 | Glycerophospholipid metabolism | 2 |
hsa00563 | Glycosylphosphatidylinositol (GPI)-anchor biosynthesis | 1 |