RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135609 | |
---|---|---|
RefMet name | LacCer 18:1;O2/16:0 | |
Alternative name | LacCer(d18:1/16:0) | |
Systematic name | N-(hexadecanoyl)-1-b-lactosyl-sphing-4-enine | |
Synonyms | PubChem Synonyms | |
Sum Composition | LacCer 34:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 861.617744 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C46H87NO13 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 31136 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C46H87NO13/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-35(50)34(47-38(51)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)33-57-45-4 3(56)41(54)44(37(32-49)59-45)60-46-42(55)40(53)39(52)36(31-48)58-46/h27,29,34-37,39-46,48-50,52-56H,3-26,28,30-33H2,1-2H3,(H,47,51 )/b29-27+/t34-,35+,36?,37?,39-,40-,41+,42?,43?,44+,45+,46-/m0/s1 | |
InChIKey | HLIJNIKSBCIDGO-QKLMXXKVSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | CCCCCCCCCCCCC/C=C/[C@H]([C@H](CO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O)NC(=O)CCCCCCCCCCCCCCC)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Sphingolipids | |
Main Class | Glycosphingolipids | |
Sub Class | Hex2Cer (Dihexosyl ceramides) | |
Distribution of LacCer 18:1;O2/16:0 in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting LacCer 18:1;O2/16:0 | |
External Links | ||
Pubchem CID | 44260140 | |
LIPID MAPS | LMSP0501AB03 | |
ChEBI ID | 84758 | |
KEGG ID | C01290 | |
HMDB ID | HMDB0006750 | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving LacCer 18:1;O2/16:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03354 | Glucosylceramide + UDP-alpha-D-galactose <=> Lactosylceramide + UDP | UDP-alpha-D-galactose:beta-D-glucosyl-(1<->1)-ceramide 4-beta-D-galactosyltransferase |
R03355 | Lactosylceramide + H2O <=> Glucosylceramide + D-Galactose | beta-D-Galactosyl-1,4-beta-D-glucosylceramide galactohydrolase |
R05937 | CMP-N-acetylneuraminate + Lactosylceramide <=> CMP + GM3 | CMP-N-acetylneuraminate + Lactosylceramide <=> CMP + GM3 |
R05938 | UDP-N-acetyl-D-galactosamine + Lactosylceramide <=> UDP + GA2 | UDP-N-acetyl-D-galactosamine + Lactosylceramide <=> UDP + GA2 |
R05971 | UDP-N-acetyl-D-glucosamine + Lactosylceramide <=> UDP + Lc3Cer | UDP-N-acetyl-D-glucosamine + Lactosylceramide <=> UDP + Lc3Cer |
R12960 | 3'-Phosphoadenylyl sulfate + Lactosylceramide <=> Adenosine 3',5'-bisphosphate + Lactosylceramide sulfate | 3'-phosphoadenylyl-sulfate:lactosylceramide 3'-sulfotransferase |
R12961 | Lactosylceramide sulfate + H2O <=> Lactosylceramide + Sulfate | lactosylceramide-sulfate sulfohydrolase |
Table of KEGG human pathways containing LacCer 18:1;O2/16:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00600 | Sphingolipid metabolism | 4 |
hsa00604 | Glycosphingolipid biosynthesis - ganglio series | 2 |
hsa01100 | Metabolic pathways | 2 |
hsa00601 | Glycosphingolipid biosynthesis - lacto and neolacto series | 1 |