RefMet Compound Details
RefMet ID | RM0155925 | |
---|---|---|
MW structure | 51014 (View MW Metabolite Database details) | |
RefMet name | Lactose | |
Systematic name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R,6R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol | |
SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]1[C@@H](CO)OC([C@@H]([C@H]1O)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Lactose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00503 | UDP-alpha-D-galactose + D-Glucose <=> UDP + Lactose | UDP-alpha-D-galactose:D-glucose 4-beta-D-galactosyltransferase |
R01678 | Lactose + H2O <=> alpha-D-Glucose + D-Galactose | Lactose galactohydrolase |
Table of KEGG human pathways containing Lactose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 2 |