RefMet Compound Details
MW structure | 34377 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Lanosterol | |
Systematic name | lanosta-8,24-dien-3beta-ol | |
SMILES | CC(=CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](C(C)(C)[C@@H]1CC3)O)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 30:2;O | View other entries in RefMet with this sum composition |
Exact mass | 426.386165 (neutral) |
Table of KEGG reactions in human pathways involving Lanosterol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03199 | (S)-2,3-Epoxysqualene <=> Lanosterol | (S)-2,3-Epoxysqualene mutase (cyclizing, lanosterol-forming) |
R05640 | Lanosterol + 3 [Reduced NADPH---hemoprotein reductase] + 3 Oxygen <=> 4,4-Dimethyl-5alpha-cholesta-8,14,24-trien-3beta-ol + Formate + 3 [Oxidized NADPH---hemoprotein reductase] + 4 H2O | lanosterol,[reduced NADPH---hemoprotein reductase]:oxygen oxidoreductase (14-methyl cleaving) |
R12323 | Lanosterol + 6 Reduced ferredoxin + 6 H+ + 3 Oxygen <=> 4,4-Dimethyl-5alpha-cholesta-8,14,24-trien-3beta-ol + Formate + 6 Oxidized ferredoxin + 4 H2O | lanosterol,reduced ferredoxin:oxygen oxidoreductase (14-methyl cleaving) |
R03689 | Lanosterol + NADPH + H+ <=> 24,25-Dihydrolanosterol + NADP+ | lanosterol delta24-reductase |
Table of KEGG human pathways containing Lanosterol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 4 |