RefMet Compound Details
RefMet ID | RM0118212 | |
---|---|---|
MW structure | 38697 (View MW Metabolite Database details) | |
RefMet name | Lansoprazole | |
Systematic name | 2-({[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methane}sulfinyl)-1H-1,3-benzodiazole | |
SMILES | Cc1c(CS(=O)c2[nH]c3ccccc3n2)nccc1OCC(F)(F)F Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 369.075883 (neutral) |
Table of KEGG reactions in human pathways involving Lansoprazole
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03625 | UDP-glucose + Acetone cyanohydrin <=> UDP + Linamarin | UDPglucose:2-hydroxy-2-methylpropanenitrile beta-D-glucosyltransferase |
R10040 | Linamarin + H2O <=> Acetone cyanohydrin + beta-D-Glucose | beta-D-glucoside glucohydrolase |
Table of KEGG human pathways containing Lansoprazole
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 2 |