RefMet Compound Details
MW structure | 52848 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Maleylacetic acid | |
Systematic name | (2Z)-4-oxohex-2-enedioic acid | |
SMILES | C(=C\C(=O)O)\C(=O)CC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 158.021525 (neutral) |
Table of KEGG reactions in human pathways involving Maleylacetic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08121 | 4-Fluoromuconolactone + H2O <=> 2-Maleylacetate + Hydrofluoric acid | 4-fluoromuconolactone lactonohydrolase |
Table of KEGG human pathways containing Maleylacetic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 1 |