RefMet Compound Details
MW structure | 2027 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Maleylacetoacetic acid | |
Systematic name | 4,6-dioxo-2Z-octenedioic acid | |
SMILES | C(=C\C(=O)O)\C(=O)CC(=O)CC(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | FA 8:4;O4 | View other entries in RefMet with this sum composition |
Exact mass | 200.032090 (neutral) |
Table of KEGG reactions in human pathways involving Maleylacetoacetic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03181 | 4-Maleylacetoacetate <=> 4-Fumarylacetoacetate | 4-Maleylacetoacetate cis-trans-isomerase |
R02519 | Homogentisate + Oxygen <=> 4-Maleylacetoacetate | Homogentisate:oxygen 1,2-oxidoreductase (decyclizing) |
Table of KEGG human pathways containing Maleylacetoacetic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00350 | Tyrosine metabolism | 2 |