RefMet Compound Details
RefMet ID | RM0139438 | |
---|---|---|
MW structure | 50143 (View MW Metabolite Database details) | |
RefMet name | Malonyl-CoA | |
Alternative name | CoA DC3:0 | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-4-{[3-({2-[(3-carboxyacetyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-3-hydroxy-2,2-dimethyl-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)[C@H](C(=O)NCCC(=O)NCCSC(=O)CC(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 3:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 853.115614 (neutral) |
Table of KEGG reactions in human pathways involving Malonyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00233 | Malonyl-CoA <=> Acetyl-CoA + CO2 | malonyl-CoA carboxy-lyase (acetyl-CoA-forming) |
R00353 | Malonyl-CoA + Pyruvate <=> Acetyl-CoA + Oxaloacetate | malonyl-CoA:pyruvate carboxytransferase |
R00742 | ATP + Acetyl-CoA + HCO3- <=> ADP + Orthophosphate + Malonyl-CoA | acetyl-CoA:carbon-dioxide ligase (ADP-forming) |
R01626 | Malonyl-CoA + Acyl-carrier protein <=> CoA + Malonyl-[acyl-carrier protein] | Malonyl-CoA:[acyl-carrier-protein] S-malonyltransferase |
R10825 | Very-long-chain acyl-CoA + Malonyl-CoA <=> Very-long-chain 3-oxoacyl-CoA + CO2 + CoA | very-long-chain acyl-CoA:malonyl-CoA C-acyltransferase (decarboxylating) |
R12300 | ATP + Malonate + CoA <=> AMP + Diphosphate + Malonyl-CoA | malonate:CoA ligase (AMP-forming) |
Table of KEGG human pathways containing Malonyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00061 | Fatty acid biosynthesis | 4 |
hsa01212 | Fatty acid metabolism | 3 |
hsa00640 | Propanoate metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |
hsa00620 | Pyruvate metabolism | 1 |
hsa00062 | Fatty acid elongation | 1 |
hsa00410 | beta-Alanine metabolism | 1 |