RefMet Compound Details
RefMet ID | RM0139031 | |
---|---|---|
MW structure | 50855 (View MW Metabolite Database details) | |
RefMet name | Maltose | |
Systematic name | alpha-D-glucopyranosyl-(1->4)-D-glucopyranose;alpha-D-glucopyranosyl-(1->4)-D-glucose | |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]1[C@@H](CO)OC([C@@H]([C@H]1O)O)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Maltose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00028 | Maltose + H2O <=> 2 D-Glucose | maltose glucohydrolase |
R01555 | Maltose + Orthophosphate <=> D-Glucose + beta-D-Glucose 1-phosphate | Maltose:phosphate 1-beta-D-glucosyltransferase |
R05196 | Amylose + n D-Glucose <=> n Maltose | 1,4-alpha-D-Glucan:1,4-alpha-D-glucan 4-alpha-D-glycosyltransferase |
R11262 | Maltodextrin + H2O <=> Maltose | maltodextrin maltohydrolase |
Table of KEGG human pathways containing Maltose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00500 | Starch and sucrose metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |