RefMet Compound Details
MW structure | 37767 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Melatonin | |
Systematic name | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide | |
SMILES | CC(=O)NCCc1c[nH]c2ccc(cc12)OC Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 232.121178 (neutral) |
Table of KEGG reactions in human pathways involving Melatonin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03130 | S-Adenosyl-L-methionine + N-Acetylserotonin <=> S-Adenosyl-L-homocysteine + Melatonin | S-Adenosyl-L-homocysteine:N-acetylserotonin O-methyltransferase |
R03629 | Melatonin + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 6-Hydroxymelatonin + [Oxidized NADPH---hemoprotein reductase] + H2O | melatonin,NADPH---hemoprotein reductase:oxygen oxidoreductase |
R03628 | Melatonin + Oxygen <=> Formyl-N-acetyl-5-methoxykynurenamine | melatonin:oxygen 2,3-dioxygenase (indole-decyclizing) |
Table of KEGG human pathways containing Melatonin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 3 |