RefMet Compound Details
RefMet ID | RM0140749 | |
---|---|---|
MW structure | 51444 (View MW Metabolite Database details) | |
RefMet name | Methacrylyl-CoA | |
Alternative name | CoA 3:1(2);2Me | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-{[3-({2-[(2-methylprop-2-enoyl)sulfanyl]ethyl}amino)-3-oxopropyl]amino}-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | C=C(C)C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 4:1 | View other entries in RefMet with this sum composition |
Exact mass | 835.141434 (neutral) |
Table of KEGG reactions in human pathways involving Methacrylyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02661 | 2-Methylpropanoyl-CoA + Acceptor <=> 2-Methylprop-2-enoyl-CoA + Reduced acceptor | 2-methylpropanoyl-CoA:(acceptor) 2,3-oxidoreductase |
R04224 | 2-Methylprop-2-enoyl-CoA + H2O <=> (S)-3-Hydroxyisobutyryl-CoA | (S)-3-Hydroxyisobutyryl-CoA hydro-lyase |
Table of KEGG human pathways containing Methacrylyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 2 |