RefMet Compound Details
MW structure | 49641 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Morphine-3-glucuronide | |
Systematic name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-{[(1S,5R,13R,14S,17R)-14-hydroxy-4-methyl-12-oxa-4-azapentacyclo[9.6.1.0^{1,13}.0^{5,17}.0^{7,18}]octadeca-7(18),8,10,15-tetraen-10-yl]oxy}oxane-2-carboxylic acid | |
SMILES | CN1CC[C@]23[C@H]4C=C[C@@H]([C@@H]3Oc3c(ccc(C[C@@H]14)c23)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 461.168582 (neutral) |
Table of KEGG reactions in human pathways involving Morphine-3-glucuronide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08262 | Morphine + UDP-glucuronate <=> Morphine-3-glucuronide + UDP | Morphine + UDP-glucuronate <=> Morphine-3-glucuronide + UDP |
Table of KEGG human pathways containing Morphine-3-glucuronide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00982 | Drug metabolism - cytochrome P450 | 1 |