RefMet Compound Details
RefMet ID | RM0157539 | |
---|---|---|
MW structure | 51812 (View MW Metabolite Database details) | |
RefMet name | N,N'-Diacetylchitobiose | |
Systematic name | 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxy-beta-D-glucopyranosyl]-2-deoxy-D-glucopyranose | |
SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](CO)OC1O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)NC(=O)C)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 424.169313 (neutral) |
Table of KEGG reactions in human pathways involving N,N'-Diacetylchitobiose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00022 | Chitobiose + H2O <=> 2 N-Acetyl-D-glucosamine | chitobiose N-acetylglucosaminohydrolase |
R02334 | Chitin + H2O <=> Chitobiose + Chitin | [1,4-(N-Acetyl-beta-D-glucosaminyl)]n glycanohydrolase |
Table of KEGG human pathways containing N,N'-Diacetylchitobiose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 2 |