RefMet Compound Details
MW structure | 67000 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Acetyl-D-glucosamine | |
Systematic name | 2-acetamido-2-deoxy-D-glucopyranose | |
SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](CO)OC1O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 221.089939 (neutral) |
Table of KEGG reactions in human pathways involving N-Acetyl-D-glucosamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00022 | Chitobiose + H2O <=> 2 N-Acetyl-D-glucosamine | chitobiose N-acetylglucosaminohydrolase |
R01201 | ATP + N-Acetyl-D-glucosamine <=> ADP + N-Acetyl-D-glucosamine 6-phosphate | ATP:N-acetyl-D-glucosamine 6-phosphotransferase |
R01206 | Chitin + H2O <=> N-Acetyl-D-glucosamine + Chitin | [1,4-(N-Acetyl-beta-D-glucosaminyl)]n glycanohydrolase |
R01207 | N-Acetyl-D-glucosamine <=> N-Acetyl-D-mannosamine | N-acetyl-D-glucosamine 2-epimerase |
Table of KEGG human pathways containing N-Acetyl-D-glucosamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 4 |