RefMet Compound Details
MW structure | 52482 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Formyl-aspartic acid | |
Systematic name | (2S)-2-(formylamino)butanedioic acid | |
SMILES | C([C@@H](C(=O)O)NC=O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 161.032424 (neutral) |
Table of KEGG reactions in human pathways involving N-Formyl-aspartic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00526 | N-Formyl-L-aspartate + H2O <=> Formate + L-Aspartate | N-Formyl-L-aspartate amidohydrolase |
Table of KEGG human pathways containing N-Formyl-aspartic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00340 | Histidine metabolism | 1 |