RefMet Compound Details
MW structure | 51990 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Formylkynurenine | |
Alternative name | N-Formyl-L-kynurenine | |
Systematic name | (2S)-2-amino-4-(2-formamidophenyl)-4-oxobutanoic acid | |
SMILES | c1ccc(c(c1)C(=O)C[C@@H](C(=O)O)N)NC=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 236.079708 (neutral) |
Table of KEGG reactions in human pathways involving N-Formylkynurenine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00678 | L-Tryptophan + Oxygen <=> L-Formylkynurenine | L-tryptophan:oxygen 2,3-oxidoreductase (decyclizing) |
R01959 | L-Formylkynurenine + H2O <=> Formate + L-Kynurenine | N-Formyl-L-kynurenine amidohydrolase |
R03936 | L-Formylkynurenine + H2O <=> Formylanthranilate + L-Alanine | Formylkynurenine hydrolase |
Table of KEGG human pathways containing N-Formylkynurenine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 3 |
hsa00630 | Glyoxylate and dicarboxylate metabolism | 1 |