RefMet Compound Details
RefMet ID | RM0030029 | |
---|---|---|
MW structure | 62863 (View MW Metabolite Database details) | |
RefMet name | N5-Formyl-THF | |
Systematic name | (6S)-5-formyltetrahydrofolic acid | |
SMILES | c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NC[C@H]1CNc2c(c(=O)[nH]c(N)n2)N1C=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 473.165898 (neutral) |
Table of KEGG reactions in human pathways involving N5-Formyl-THF
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02300 | Folinic acid <=> 5,10-Methenyltetrahydrofolate + H2O | S-Aminomethyldihydrolipoylprotein:(6S)-tetrahydrofolate aminomethyltransferase (ammonia-forming) |
R02301 | ATP + Folinic acid + H+ <=> ADP + Orthophosphate + 5,10-Methenyltetrahydrofolate | 5-Formyltetrahydrofolate cyclo-ligase (ADP-forming) |
R03189 | Folinic acid + L-Glutamate <=> Tetrahydrofolate + N-Formyl-L-glutamate | 5-Formyltetrahydrofolate:L-glutamate N-formiminotransferase |
Table of KEGG human pathways containing N5-Formyl-THF
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00670 | One carbon pool by folate | 3 |