RefMet Compound Details
MW structure | 27166 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Naringenin | |
Systematic name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one | |
SMILES | c1cc(ccc1[C@@H]1CC(=O)c2c(cc(cc2O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 272.068475 (neutral) |
Table of KEGG reactions in human pathways involving Naringenin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R13081 | Naringenin 7-O-beta-D-glucoside + H2O <=> Naringenin + beta-D-Glucose | naringenin 7-O-beta-D-glucoside glucohydrolase |
R02897 | UDP-glucose + Naringenin <=> UDP + Naringenin 7-O-beta-D-glucoside | UDPglucose:flavanone 7-O-beta-D-glucosyltransferase |
Table of KEGG human pathways containing Naringenin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 2 |