RefMet Compound Details
RefMet ID | RM0136059 | |
---|---|---|
MW structure | 37620 (View MW Metabolite Database details) | |
RefMet name | Nicotinic acid mononucleotide | |
Systematic name | 3-carboxy-1-[(2R,3R,4S,5R)-5-[(hydrogen phosphonatooxy)methyl]-3,4-dihydroxyoxolan-2-yl]-2,3-dihydro-1$l^{5}-pyridin-1-ylium | |
SMILES | C1=CC(C[N+](=C1)[C@H]1[C@@H]([C@@H]([C@@H](COP(=O)(O)[O-])O1)O)O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 337.056268 (neutral) |
Table of KEGG reactions in human pathways involving Nicotinic acid mononucleotide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01724 | Nicotinate D-ribonucleotide + Diphosphate + ADP + Orthophosphate <=> Nicotinate + 5-Phospho-alpha-D-ribose 1-diphosphate + ATP + H2O + H+ | 5-phospho-alpha-D-ribose 1-diphosphate:nicotinate ligase (ADP, diphosphate-forming) |
R03004 | Deamino-NAD+ + H2O <=> AMP + Nicotinate D-ribonucleotide | Deamino-NAD+ nucleotidohydrolase |
R03005 | ATP + Nicotinate D-ribonucleotide <=> Diphosphate + Deamino-NAD+ | ATP:nicotinamide-nucleotide adenylyltransferase |
R03346 | Nicotinate D-ribonucleotide + H2O <=> Nicotinate D-ribonucleoside + Orthophosphate | nicotinate D-ribonucleotide phosphohydrolase |
R03347 | Nicotinate D-ribonucleotide + ADP <=> Nicotinate D-ribonucleoside + ATP | ATP:beta-D-ribosylnicotinate 5-phosphotransferase |
R03348 | Nicotinate D-ribonucleotide + Diphosphate + CO2 <=> Quinolinate + 5-Phospho-alpha-D-ribose 1-diphosphate | Nicotinate-nucleotide:pyrophosphate phosphoribosyltransferase (carboxylating) |
Table of KEGG human pathways containing Nicotinic acid mononucleotide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00760 | Nicotinate and nicotinamide metabolism | 6 |