RefMet Compound Details
MW structure | 71801 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Norcodeine | |
Systematic name | (4R,12bS)-9-methoxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7-ol | |
SMILES | COc1ccc2C[C@@H]3C4C=CC(C5[C@]4(CCN3)c2c1O5)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 285.136494 (neutral) |
Table of KEGG reactions in human pathways involving Norcodeine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08264 | Codeine + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Norcodeine + Formaldehyde + [Oxidized NADPH---hemoprotein reductase] + H2O | Codeine + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> Norcodeine + Formaldehyde + [Oxidized NADPH---hemoprotein reductase] + H2O |
Table of KEGG human pathways containing Norcodeine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00982 | Drug metabolism - cytochrome P450 | 1 |