RefMet Compound Details
MW structure | 41126 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | OPC4-CoA | |
SMILES | CC/C=C\C[C@H]1C(CCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]2[C@@H](C([C@H](n3cnc4c(N)ncnc34)O2)O)OP(=O)(O)O)O)CCC1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 14:3;O | View other entries in RefMet with this sum composition |
Exact mass | 987.261549 (neutral) |
Table of KEGG reactions in human pathways involving OPC4-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07896 | OPC4-CoA + FAD <=> trans-2-Enoyl-OPC4-CoA + FADH2 | OPC4-CoA + FAD <=> trans-2-Enoyl-OPC4-CoA + FADH2 |
R07895 | OPC4-CoA + Acetyl-CoA <=> CoA + 3-Oxo-OPC6-CoA | OPC4-CoA + Acetyl-CoA <=> CoA + 3-Oxo-OPC6-CoA |
Table of KEGG human pathways containing OPC4-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00592 | alpha-Linolenic acid metabolism | 2 |