RefMet Compound Details
RefMet ID | RM0140727 | |
---|---|---|
MW structure | 50146 (View MW Metabolite Database details) | |
RefMet name | Oleoyl-CoA | |
Alternative name | CoA 18:1 | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(9Z)-octadec-9-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCCCCCCC/C=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 18:1 | View other entries in RefMet with this sum composition |
Exact mass | 1031.360534 (neutral) |
Table of KEGG reactions in human pathways involving Oleoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08176 | Oleoyl-CoA + H2O <=> CoA + (9Z)-Octadecenoic acid | oleoyl-CoA hydrolase |
R12167 | Oleoyl-CoA + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> (6Z,9Z)-Octadecadienoyl-CoA + 2 Ferricytochrome b5 + 2 H2O | oleoyl-CoA,ferrocytochrome-b5:oxygen oxidoreductase (6,7 cis-dehydrogenating) |
Table of KEGG human pathways containing Oleoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 2 |
hsa01212 | Fatty acid metabolism | 1 |