RefMet Compound Details
MW structure | 38741 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Ophthalmic acid | |
Systematic name | (2S)-2-amino-4-{[(1S)-1-[(carboxymethyl)carbamoyl]propyl]carbamoyl}butanoic acid | |
SMILES | CC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 289.127387 (neutral) |
Table of KEGG reactions in human pathways involving Ophthalmic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R10994 | ATP + gamma-L-Glutamyl-L-2-aminobutyrate + Glycine <=> ADP + Orthophosphate + Ophthalmate | gamma-L-glutamyl-L-2-aminobutyrate:glycine ligase (ADP-forming) |
Table of KEGG human pathways containing Ophthalmic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00270 | Cysteine and methionine metabolism | 1 |