RefMet Compound Details
MW structure | 56573 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Oxalosuccinic acid | |
Systematic name | 1-oxopropane-1,2,3-tricarboxylic acid | |
SMILES | C([C@@H](C(=O)C(=O)O)C(=O)O)C(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 190.011355 (neutral) |
Table of KEGG reactions in human pathways involving Oxalosuccinic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00268 | Oxalosuccinate <=> 2-Oxoglutarate + CO2 | oxalosuccinate carboxy-lyase (2-oxoglutarate-forming) |
R01899 | Isocitrate + NADP+ <=> Oxalosuccinate + NADPH + H+ | Isocitrate:NADP+ oxidoreductase |
Table of KEGG human pathways containing Oxalosuccinic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00020 | Citrate cycle (TCA cycle) | 2 |
hsa01210 | 2-Oxocarboxylic acid metabolism | 2 |