RefMet Compound Details
RefMet ID | RM0096350 | |
---|---|---|
MW structure | 91101 (View MW Metabolite Database details) | |
RefMet name | PE 10:0/4:0 | |
Alternative name | PE(10:0/4:0) | |
Systematic name | 1-decanoyl-2-butyryl-sn-glycero-3-phosphoethanolamine | |
SMILES | CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCC Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | PE 14:0 | View other entries in RefMet with this sum composition |
Exact mass | 439.233507 (neutral) |
Table of KEGG reactions in human pathways involving PE 10:0/4:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02051 | Phosphatidylethanolamine + H2O <=> Ethanolamine + Phosphatidate | phosphatidylethanolamine phosphatidohydrolase |
R02053 | Phosphatidylethanolamine + H2O <=> 1-Acyl-sn-glycero-3-phosphoethanolamine + Fatty acid | phosphatidylethanolamine 2-acylhydrolase |
R02054 | Phosphatidylethanolamine + H2O <=> 2-Acyl-sn-glycero-3-phosphoethanolamine + Fatty acid | phosphatidylethanolamine 1-acylhydrolase |
R02055 | Phosphatidylserine <=> Phosphatidylethanolamine + CO2 | Phsophatidyl-L-serine carboxy-lyase |
R02056 | S-Adenosyl-L-methionine + Phosphatidylethanolamine <=> S-Adenosyl-L-homocysteine + Phosphatidyl-N-methylethanolamine | S-adenosyl-L-methionine:phosphatidylethanolamine N-methyltransferase |
R02057 | CDP-ethanolamine + 1,2-Diacyl-sn-glycerol <=> CMP + Phosphatidylethanolamine | CDPethanolamine:1,2-diacylglycerol ethanolaminephosphotransferase |
R04480 | Phosphatidylethanolamine + CoA <=> 1-Acyl-sn-glycero-3-phosphoethanolamine + Acyl-CoA | Acyl-CoA:1-acyl-sn-glycero-3-phosphoethanolamine O-acyltransferase |
R07376 | Phosphatidylethanolamine + L-Serine <=> Phosphatidylserine + Ethanolamine | L-1-phosphatidylethanolamine:L-serine phosphatidyltransferase |
R08107 | Phosphatidylethanolamine + G00149 <=> 1,2-Diacyl-sn-glycerol + G13044 | Phosphatidylethanolamine + G00149 <=> 1,2-Diacyl-sn-glycerol + G13044 |
R12351 | G13128 + Phosphatidylethanolamine <=> G00148 + 1,2-Diacyl-sn-glycerol | G13128 + Phosphatidylethanolamine <=> G00148 + 1,2-Diacyl-sn-glycerol |
R12702 | Phosphatidylethanolamine + G13044 <=> 1,2-Diacyl-sn-glycerol + G13152 | GPI ethanolamine phosphate transferase 2/3 subunit F |
Table of KEGG human pathways containing PE 10:0/4:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00564 | Glycerophospholipid metabolism | 8 |
hsa00563 | Glycosylphosphatidylinositol (GPI)-anchor biosynthesis | 3 |
hsa01100 | Metabolic pathways | 1 |