RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0133808 | |
---|---|---|
RefMet name | PE 18:1(9Z)/18:2(9Z,12Z) | |
Systematic name | 1-(9Z-octadecenoyl)-2-(9Z,12Z-octadecadienoyl)-sn-glycero-3-phosphoethanolamine | |
Synonyms | PubChem Synonyms | |
Exact mass | 741.5309 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C41H76NO8P | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 15166 (Download molfile/View MW Metabolite Database details) | |
InChI | ||
InChIKey | GKAFCSRKMWFPSJ-RJXNKANHSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | CCCCCCCC/C=CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=CC/C=CCCCCC
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Glycerophospholipids | |
Main Class | Glycerophosphoethanolamines | |
Sub Class | PE (Phosphatidylethanolamines) | |
Distribution of PE 18:1(9Z)/18:2(9Z,12Z) in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting PE 18:1(9Z)/18:2(9Z,12Z) | |
External Links | ||
Pubchem CID | 9546753 | |
LIPID MAPS | LMGP02010048 | |
ChEBI ID | 74977 | |
KEGG ID | C00350 | |
HMDB ID | HMDB0009060 | |
Chemspider ID | 7825703 | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving PE 18:1(9Z)/18:2(9Z,12Z)
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02051 | Phosphatidylethanolamine + H2O <=> Ethanolamine + Phosphatidate | phosphatidylethanolamine phosphatidohydrolase |
R02053 | Phosphatidylethanolamine + H2O <=> 1-Acyl-sn-glycero-3-phosphoethanolamine + Fatty acid | phosphatidylethanolamine 2-acylhydrolase |
R02054 | Phosphatidylethanolamine + H2O <=> 2-Acyl-sn-glycero-3-phosphoethanolamine + Fatty acid | phosphatidylethanolamine 1-acylhydrolase |
R02055 | Phosphatidylserine <=> Phosphatidylethanolamine + CO2 | Phsophatidyl-L-serine carboxy-lyase |
R02056 | S-Adenosyl-L-methionine + Phosphatidylethanolamine <=> S-Adenosyl-L-homocysteine + Phosphatidyl-N-methylethanolamine | S-adenosyl-L-methionine:phosphatidylethanolamine N-methyltransferase |
R02057 | CDP-ethanolamine + 1,2-Diacyl-sn-glycerol <=> CMP + Phosphatidylethanolamine | CDPethanolamine:1,2-diacylglycerol ethanolaminephosphotransferase |
R04480 | Phosphatidylethanolamine + CoA <=> 1-Acyl-sn-glycero-3-phosphoethanolamine + Acyl-CoA | Acyl-CoA:1-acyl-sn-glycero-3-phosphoethanolamine O-acyltransferase |
R07376 | Phosphatidylethanolamine + L-Serine <=> Phosphatidylserine + Ethanolamine | L-1-phosphatidylethanolamine:L-serine phosphatidyltransferase |
R08107 | Phosphatidylethanolamine + G00149 <=> 1,2-Diacyl-sn-glycerol + G13044 | Phosphatidylethanolamine + G00149 <=> 1,2-Diacyl-sn-glycerol + G13044 |
R12351 | G13128 + Phosphatidylethanolamine <=> G00148 + 1,2-Diacyl-sn-glycerol | G13128 + Phosphatidylethanolamine <=> G00148 + 1,2-Diacyl-sn-glycerol |
R12702 | Phosphatidylethanolamine + G13044 <=> 1,2-Diacyl-sn-glycerol + G13152 | GPI ethanolamine phosphate transferase 2/3 subunit F |
Table of KEGG human pathways containing PE 18:1(9Z)/18:2(9Z,12Z)
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00564 | Glycerophospholipid metabolism | 8 |
hsa00563 | Glycosylphosphatidylinositol (GPI)-anchor biosynthesis | 3 |
hsa01100 | Metabolic pathways | 1 |