RefMet Compound Details
MW structure | 16427 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | PS 10:0/10:0 | |
Alternative name | PS(10:0/10:0) | |
SMILES | CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](C(=O)O)N)OC(=O)CCCCCCCCC Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | PS 20:0 | View other entries in RefMet with this sum composition |
Exact mass | 567.317237 (neutral) |
Table of KEGG reactions in human pathways involving PS 10:0/10:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02055 | Phosphatidylserine <=> Phosphatidylethanolamine + CO2 | Phsophatidyl-L-serine carboxy-lyase |
R07376 | Phosphatidylethanolamine + L-Serine <=> Phosphatidylserine + Ethanolamine | L-1-phosphatidylethanolamine:L-serine phosphatidyltransferase |
R09035 | Acyl-CoA + 1-Acyl-sn-glycero-3-phosphoserine <=> CoA + Phosphatidylserine | acyl-CoA:1-acyl-sn-glycero-3-phosphoserine O-acyltransferase |
R07377 | Phosphatidylcholine + L-Serine <=> Phosphatidylserine + Choline | Phosphatidylcholine + L-Serine <=> Phosphatidylserine + Choline |
R04034 | Phosphatidylserine + H2O <=> 2-Acyl-sn-glycero-3-phosphoserine + Fatty acid | 3-sn-phosphatidyl-L-serine sn-1 acylhydrolase |
Table of KEGG human pathways containing PS 10:0/10:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00564 | Glycerophospholipid metabolism | 5 |