RefMet Compound Details
| RefMet ID, RefMet name, exact mass and formula | ||
| RefMet ID | RM0034093 | |
|---|---|---|
| RefMet name | Palatinose | |
| Systematic name | 6-O-alpha-D-Glucopyranosyl-D-fructofuranose | |
| Synonyms | PubChem Synonyms | |
| Exact mass | 342.116215 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
| Formula | C12H22O11 | View other entries in RefMet with this formula |
| Molecular descriptors | ||
| Molfile | 49906 (Download molfile/View MW Metabolite Database details) | |
| InChI | InChI=1S/C12H22O11/c13-1-4-6(15)8(17)9(18)11(22-4)21-2-5-7(16)10(19)12(20,3-14)23-5/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11+, 12?/m1/s1 | |
| InChIKey | PVXPPJIGRGXGCY-TZLCEDOOSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](OC[C@@H]2[C@H]([C@@H](C(CO)(O)O2)O)O)O1)O)O)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
| Chemical/Biochemical Classification | ||
| Super Class | Carbohydrates | |
| Main Class | Disaccharides | |
| Sub Class | Disaccharides | |
| Distribution of Palatinose in NMDR studies | ||
| Species | Plot Species distribution | |
| Sample source | Plot Sample source(tissue) distribution | |
| Platform | Platform (MS/NMR) used for detection | |
| Chromatography | Chromatography methods used for detection | |
| Studies | NMDR Studies reporting Palatinose | |
| External Links | ||
| Pubchem CID | 439559 | |
| ChEBI ID | 18394 | |
| KEGG ID | C01742 | |
| HMDB ID | HMDB0256083 | |
| MetaCyc ID | CPD-230 | |
| Spectral data for Palatinose standards | ||
| MassBank(EU) | View MS spectra | |
| Structural annotation level | ||
| Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) | |
