RefMet Compound Details
MW structure | 58565 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Palmitoleoyl-CoA | |
Alternative name | CoA 16:1 | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(9Z)-hexadec-9-enoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCCCCC/C=C\CCCCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 16:1 | View other entries in RefMet with this sum composition |
Exact mass | 1003.329234 (neutral) |
Table of KEGG reactions in human pathways involving Palmitoleoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R12173 | Palmitoyl-CoA + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> Palmitoleoyl-CoA + 2 Ferricytochrome b5 + 2 H2O | palmitoyl-CoA,ferrocytochrome-b5:oxygen oxidoreductase (9,10-dehydrogenating) |
Table of KEGG human pathways containing Palmitoleoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 1 |