RefMet Compound Details

RefMet ID	RM0047891
MW structure	37896 (View MW Metabolite Database details)
RefMet name	Paraxanthine
Systematic name	1,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
SMILES	Cn1cnc2c1c(=O)n(C)c(=O)[nH]2   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass	180.064726 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C7H8N4O2	View other entries in RefMet with this formula
InChI	InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3H,1-2H3,(H,9,13)
InChIKey	QUNWUDVFRNGTCO-UHFFFAOYSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
Super Class	Nucleic acids
Main Class	Purines
Sub Class	Xanthines
Pubchem CID	4687
ChEBI ID	25858
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Paraxanthine

Rxn ID	KEGG Reaction	Enzyme
R07939	Caffeine + NADPH + Oxygen + H+ <=> 1,7-Dimethylxanthine + NADP+ + Formaldehyde + H2O	caffeine:oxygen oxidoreductase (N3-demethylating)
R07940	1,7-Dimethylxanthine <=> 5-Acetylamino-6-formylamino-3-methyluracil	1,7-Dimethylxanthine <=> 5-Acetylamino-6-formylamino-3-methyluracil
R07943	1,7-Dimethylxanthine <=> 1-Methylxanthine	1,7-Dimethylxanthine <=> 1-Methylxanthine
R07945	1,7-Dimethylxanthine <=> 1,7-Dimethyluric acid	1,7-Dimethylxanthine <=> 1,7-Dimethyluric acid
R07954	Caffeine + NADH + H+ + Oxygen <=> 1,7-Dimethylxanthine + NAD+ + Formaldehyde + H2O	caffeine:oxygen oxidoreductase (N3-demethylating)
R07959	1,7-Dimethylxanthine + NADH + H+ + Oxygen <=> 1-Methylxanthine + NAD+ + Formaldehyde + H2O	1,7-Dimethylxanthine + NADH + H+ + Oxygen <=> 1-Methylxanthine + NAD+ + Formaldehyde + H2O
R07960	1,7-Dimethylxanthine + NADPH + H+ + Oxygen <=> 1-Methylxanthine + NADP+ + Formaldehyde + H2O	1,7-Dimethylxanthine + NADPH + H+ + Oxygen <=> 1-Methylxanthine + NADP+ + Formaldehyde + H2O
R07977	1,7-Dimethylxanthine + Oxygen + H2O <=> 1,7-Dimethyluric acid + Hydrogen peroxide	1,7-dimethylxanthine:oxygen oxidoreductase

Table of KEGG human pathways containing Paraxanthine

Pathway ID	Human Pathway	# of reactions
hsa00232	Caffeine metabolism	5
hsa01100	Metabolic pathways	3