RefMet Compound Details
MW structure | 37896 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Paraxanthine | |
Systematic name | 1,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione | |
SMILES | Cn1cnc2c1c(=O)n(C)c(=O)[nH]2 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 180.064726 (neutral) |
Table of KEGG reactions in human pathways involving Paraxanthine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07945 | 1,7-Dimethylxanthine <=> 1,7-Dimethyluric acid | 1,7-Dimethylxanthine <=> 1,7-Dimethyluric acid |
R07954 | Caffeine + NADH + H+ + Oxygen <=> 1,7-Dimethylxanthine + NAD+ + Formaldehyde + H2O | caffeine:oxygen oxidoreductase (N3-demethylating) |
R07960 | 1,7-Dimethylxanthine + NADPH + H+ + Oxygen <=> 1-Methylxanthine + NADP+ + Formaldehyde + H2O | 1,7-Dimethylxanthine + NADPH + H+ + Oxygen <=> 1-Methylxanthine + NADP+ + Formaldehyde + H2O |
R07940 | 1,7-Dimethylxanthine <=> 5-Acetylamino-6-formylamino-3-methyluracil | 1,7-Dimethylxanthine <=> 5-Acetylamino-6-formylamino-3-methyluracil |
R07977 | 1,7-Dimethylxanthine + Oxygen + H2O <=> 1,7-Dimethyluric acid + Hydrogen peroxide | 1,7-dimethylxanthine:oxygen oxidoreductase |
R07939 | Caffeine + NADPH + Oxygen + H+ <=> 1,7-Dimethylxanthine + NADP+ + Formaldehyde + H2O | caffeine:oxygen oxidoreductase (N3-demethylating) |
R07943 | 1,7-Dimethylxanthine <=> 1-Methylxanthine | 1,7-Dimethylxanthine <=> 1-Methylxanthine |
R07959 | 1,7-Dimethylxanthine + NADH + H+ + Oxygen <=> 1-Methylxanthine + NAD+ + Formaldehyde + H2O | 1,7-Dimethylxanthine + NADH + H+ + Oxygen <=> 1-Methylxanthine + NAD+ + Formaldehyde + H2O |
Table of KEGG human pathways containing Paraxanthine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00232 | Caffeine metabolism | 5 |
hsa01100 | Metabolic pathways | 3 |