RefMet Compound Details
MW structure | 37174 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Phosphoserine | |
Systematic name | (2S)-2-amino-3-(phosphonooxy)propanoic acid | |
SMILES | C([C@@H](C(=O)O)N)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 185.008927 (neutral) |
Table of KEGG reactions in human pathways involving Phosphoserine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R12342 | ADP + L-Serine <=> AMP + O-Phospho-L-serine | ADP:L-serine 3-phosphotransferase |
R04173 | O-Phospho-L-serine + 2-Oxoglutarate <=> 3-Phosphonooxypyruvate + L-Glutamate | 3-Phosphoserine:2-oxoglutarate aminotransferase |
R12344 | ATP + L-Serine <=> ADP + O-Phospho-L-serine | ATP:L-serine 3-phosphotransferase |
R00582 | O-Phospho-L-serine + H2O <=> L-Serine + Orthophosphate | O-phospho-L-serine phosphohydrolase |
Table of KEGG human pathways containing Phosphoserine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00260 | Glycine, serine and threonine metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |
hsa01200 | Carbon metabolism | 2 |
hsa01230 | Biosynthesis of amino acids | 2 |
hsa00270 | Cysteine and methionine metabolism | 1 |