RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135447 | |
---|---|---|
RefMet name | Phytosphingosine | |
Systematic name | 4R-hydroxysphinganine | |
Synonyms | PubChem Synonyms | |
Exact mass | 317.292994 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C18H39NO3 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 30478 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3/t16-,17+,18-/m0/s1 | |
InChIKey | AERBNCYCJBRYDG-KSZLIROESA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | CCCCCCCCCCCCCC[C@H]([C@H]([C@H](CO)N)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Sphingolipids | |
Main Class | Sphingoid bases | |
Sub Class | Phytosphingosines | |
Distribution of Phytosphingosine in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Phytosphingosine | |
External Links | ||
Pubchem CID | 122121 | |
LIPID MAPS | LMSP01030001 | |
ChEBI ID | 46961 | |
KEGG ID | C12144 | |
HMDB ID | HMDB0004610 | |
Chemspider ID | 108921 | |
MetaCyc ID | PHYTOSPINGOSINE | |
EPA CompTox | DTXCID60200847 | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Phytosphingosine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R06525 | Sphinganine + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> Phytosphingosine + 2 Ferricytochrome b5 + H2O | sphinganine,ferrocytochrome b5:oxygen oxidoreductase (C4-hydroxylating) |
R06527 | C26-CoA + Phytosphingosine <=> CoA + Phytoceramide | acyl-CoA: phytosphingosine N-acyltransferase |
R06528 | Phytoceramide + H2O <=> Fatty acid + Phytosphingosine | Phytoceramide amidohydrolase |
Table of KEGG human pathways containing Phytosphingosine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00600 | Sphingolipid metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |