RefMet Compound Details
| RefMet ID, RefMet name, exact mass and formula | ||
| RefMet ID | RM0043248 | |
|---|---|---|
| RefMet name | Piperine | |
| Systematic name | (2E,4E)-5-(2H-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)penta-2,4-dien-1-one | |
| Synonyms | PubChem Synonyms | |
| Exact mass | 285.136494 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
| Formula | C17H19NO3 | View other entries in RefMet with this formula |
| Molecular descriptors | ||
| Molfile | 43799 (Download molfile/View MW Metabolite Database details) | |
| InChI | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ | |
| InChIKey | MXXWOMGUGJBKIW-YPCIICBESA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
| SMILES | C1CCN(CC1)C(=O)/C=C/C=C/c1ccc2c(c1)OCO2
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
| Chemical/Biochemical Classification | ||
| Super Class | Alkaloids | |
| Main Class | Lysine alkaloids | |
| Sub Class | Piperidine alkaloids | |
| Distribution of Piperine in NMDR studies | ||
| Species | Plot Species distribution | |
| Sample source | Plot Sample source(tissue) distribution | |
| Platform | Platform (MS/NMR) used for detection | |
| Chromatography | Chromatography methods used for detection | |
| Studies | NMDR Studies reporting Piperine | |
| External Links | ||
| Pubchem CID | 638024 | |
| ChEBI ID | 28821 | |
| KEGG ID | C03882 | |
| HMDB ID | HMDB0029377 | |
| Chemspider ID | 553590 | |
| MetaCyc ID | N-EE-PIPEROYL-PIPERIDINE | |
| EPA CompTox | DTXCID00809656 | |
| PhytoHub DB | PHUB000843 | |
| NPAtlas DB | NP015865 | |
| Spectral data for Piperine standards | ||
| NP-MRD ID(NMR) | View NMR spectra | |
| MassBank(EU) | View MS spectra | |
| Structural annotation level | ||
| Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) | |
