RefMet Compound Details

RefMet IDRM0128390
MW structure35392 (View MW Metabolite Database details)
RefMet namePregnenolone
Systematic name3beta-hydroxypregn-5-en-20-one
SMILESCC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Sum CompositionST 21:2;O2 View other entries in RefMet with this sum composition
Exact mass316.240230 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC21H32O2View other entries in RefMet with this formula
InChIInChI=1S/C21H32O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,15-19,23H,5-12H2,1-3H3/t15-,16-,17+,
18-,19-,20-,21+/m0/s1
InChIKeyORNBQBCIOKFOEO-QGVNFLHTSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassSterol Lipids
Main ClassSteroids
Sub ClassC21 Steroids
Pubchem CID8955
ChEBI ID16581
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Pregnenolone

Rxn IDKEGG ReactionEnzyme
R02216 Pregnenolone + NAD+ <=> Progesterone + NADH + H+Pregnenolone:NAD+ 3-oxidoreductase
R03783 Pregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 17alpha-Hydroxypregnenolone + [Oxidized NADPH---hemoprotein reductase] + H2Opregnenolone,NADPH-hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating)
R03784 Pregnenolone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 21-Hydroxypregnenolone + [Oxidized NADPH---hemoprotein reductase] + H2Opregnenolone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating)
R03933 20alpha,22beta-Dihydroxycholesterol + Oxygen + 2 Reduced adrenal ferredoxin + 2 H+ <=> 4-Methylpentanal + Pregnenolone + 2 H2O + 2 Oxidized adrenal ferredoxin20alpha,22beta-Dihydroxycholesterol,ferredoxin:oxygen oxidoreductase (side-chain-cleaving)
R08942 Pregnenolone + Sulfate <=> 3beta-Hydroxypregn-5-en-20-one sulfate + H2OPregnenolone-sulfate sulfohydrolase
R08943 Pregnenolone + NADPH + H+ + Oxygen <=> 7alpha-Hydroxypregnenolone + NADP+ + H2Opregnenolone,NADPH:oxygen oxidoreductase (7alpha-hydroxylating)
R08978 Pregnenolone + 3'-Phosphoadenylyl sulfate <=> 3beta-Hydroxypregn-5-en-20-one sulfate + Adenosine 3',5'-bisphosphate3'-phosphoadenylyl-sulfate:pregnenolone sulfotransferase

Table of KEGG human pathways containing Pregnenolone

Pathway IDHuman Pathway# of reactions
hsa00140 Steroid hormone biosynthesis 7
  logo