RefMet Compound Details
RefMet ID | RM0138917 | |
---|---|---|
MW structure | 36956 (View MW Metabolite Database details) | |
RefMet name | Pregnenolone sulfate | |
Systematic name | 20-oxopregn-5-en-3beta-yl sulfate | |
SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OS(=O)(=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O2;S | View other entries in RefMet with this sum composition |
Exact mass | 396.197047 (neutral) |
Table of KEGG reactions in human pathways involving Pregnenolone sulfate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08942 | Pregnenolone + Sulfate <=> 3beta-Hydroxypregn-5-en-20-one sulfate + H2O | Pregnenolone-sulfate sulfohydrolase |
R08978 | Pregnenolone + 3'-Phosphoadenylyl sulfate <=> 3beta-Hydroxypregn-5-en-20-one sulfate + Adenosine 3',5'-bisphosphate | 3'-phosphoadenylyl-sulfate:pregnenolone sulfotransferase |
Table of KEGG human pathways containing Pregnenolone sulfate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |