RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135671 | |
---|---|---|
RefMet name | Progesterone | |
Systematic name | pregn-4-ene-3,20-dione | |
Synonyms | PubChem Synonyms | |
Sum Composition | ST 21:3;O2 | View other entries in RefMet with this sum composition |
Exact mass | 314.224580 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C21H30O2 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 35438 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19 -,20-,21+/m0/s1 | |
InChIKey | RJKFOVLPORLFTN-LEKSSAKUSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Sterol Lipids | |
Main Class | Steroids | |
Sub Class | C21 Steroids | |
Distribution of Progesterone in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Progesterone | |
External Links | ||
Pubchem CID | 5994 | |
LIPID MAPS | LMST02030159 | |
ChEBI ID | 17026 | |
KEGG ID | C00410 | |
HMDB ID | HMDB0001830 | |
Chemspider ID | 5773 | |
MetaCyc ID | PROGESTERONE | |
EPA CompTox | DTXCID20208869 | |
Spectral data for Progesterone standards | ||
BMRB ID(NMR) | View NMR spectra | |
NP-MRD ID(NMR) | View NMR spectra | |
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Progesterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02207 | 20alpha-Hydroxy-4-pregnen-3-one + NAD+ <=> Progesterone + NADH + H+ | 20alpha-Hydroxy-4-pregnen-3-one:NAD+ 20-oxidoreductase |
R02208 | 5alpha-Pregnane-3,20-dione + NADP+ <=> Progesterone + NADPH + H+ | 5alpha-pregnane-3,20-dione:NADP+ delta4-oxidoreductase |
R02209 | 20alpha-Hydroxy-4-pregnen-3-one + NADP+ <=> Progesterone + NADPH + H+ | 20alpha-Hydroxy-4-pregnen-3-one:NADP+ 20-oxidoreductase |
R02211 | Progesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 17alpha-Hydroxyprogesterone + [Oxidized NADPH---hemoprotein reductase] + H2O | progesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (17alpha-hydroxylating) |
R02213 | Progesterone + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> 11-Deoxycorticosterone + [Oxidized NADPH---hemoprotein reductase] + H2O | progesterone,NADPH-hemoprotein reductase:oxygen oxidoreductase (21-hydroxylating) |
R02215 | 5beta-Pregnane-3,20-dione + Acceptor <=> Progesterone + Reduced acceptor | 5beta-Pregnane-3,20-dione:(acceptor) delta4-oxidoreductase |
R02216 | Pregnenolone + NAD+ <=> Progesterone + NADH + H+ | Pregnenolone:NAD+ 3-oxidoreductase |
R02218 | Progesterone + 2 Reduced ferredoxin + Oxygen + 2 H+ <=> 11beta-Hydroxyprogesterone + 2 Oxidized ferredoxin + H2O | progesterone,reduced ferredoxin:oxygen oxidoreductase (11-hydroxylating) |
R02219 | Progesterone + NADPH + H+ <=> 5beta-Pregnane-3,20-dione + NADP+ | 3-Oxo-5beta-steroid:NADP+ delta4-oxidoreductase |
Table of KEGG human pathways containing Progesterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 8 |
hsa01100 | Metabolic pathways | 3 |