RefMet Compound Details
RefMet ID, RefMet name, exact mass and formula | ||
RefMet ID | RM0135899 | |
---|---|---|
RefMet name | Proline | |
Systematic name | (2S)-pyrrolidine-2-carboxylic acid | |
Synonyms | PubChem Synonyms | |
Exact mass | 115.063329 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
Formula | C5H9NO2 | View other entries in RefMet with this formula |
Molecular descriptors | ||
Molfile | 37110 (Download molfile/View MW Metabolite Database details) | |
InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1 | |
InChIKey | ONIBWKKTOPOVIA-BYPYZUCNSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
SMILES | C1C[C@@H](C(=O)O)NC1
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Chemical/Biochemical Classification | ||
Super Class | Organic acids | |
Main Class | Amino acids and peptides | |
Sub Class | Amino acids | |
Distribution of Proline in NMDR studies | ||
Species | Plot Species distribution | |
Sample source | Plot Sample source(tissue) distribution | |
Platform | Platform (MS/NMR) used for detection | |
Chromatography | Chromatography methods used for detection | |
Studies | NMDR Studies reporting Proline | |
External Links | ||
Pubchem CID | 145742 | |
ChEBI ID | 17203 | |
KEGG ID | C00148 | |
HMDB ID | HMDB0000162 | |
Chemspider ID | 128566 | |
MetaCyc ID | PRO | |
EPA CompTox | DTXCID7021104 | |
Spectral data for Proline standards | ||
BMRB ID(NMR) | View NMR spectra | |
NP-MRD ID(NMR) | View NMR spectra | |
MassBank(EU) | View MS spectra | |
Structural annotation level | ||
Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) |
Table of KEGG reactions in human pathways involving Proline
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00135 | Peptide + H2O <=> L-Proline + Peptide | Peptide + H2O <=> L-Proline + Peptide |
R01248 | L-Proline + NAD+ <=> (S)-1-Pyrroline-5-carboxylate + NADH + H+ | L-Proline:NAD+ 5-oxidoreductase |
R01251 | L-Proline + NADP+ <=> (S)-1-Pyrroline-5-carboxylate + NADPH + H+ | L-Proline:NADP+ 5-oxidoreductase |
R01252 | L-Proline + 2-Oxoglutarate + Oxygen <=> Hydroxyproline + Succinate + CO2 | L-Proline,2-oxoglutarate:oxygen oxidoreductase (4-hydroxylating) |
R01253 | L-Proline + Quinone <=> (S)-1-Pyrroline-5-carboxylate + Hydroquinone | L-proline:quinone oxidoreductase |
R03661 | ATP + L-Proline + tRNA(Pro) <=> AMP + Diphosphate + L-Prolyl-tRNA(Pro) | L-proline:tRNA(Pro) ligase (AMP-forming) |
R10507 | L-Proline + FAD <=> (S)-1-Pyrroline-5-carboxylate + FADH2 | L-proline:(acceptor) oxidoreductase |
Table of KEGG human pathways containing Proline
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00330 | Arginine and proline metabolism | 6 |
hsa01100 | Metabolic pathways | 4 |
hsa01230 | Biosynthesis of amino acids | 2 |
hsa00970 | Aminoacyl-tRNA biosynthesis | 1 |