RefMet Compound Details
MW structure | 46761 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Prunasin | |
Systematic name | (2R)-(beta-D-Glucopyranosyloxy)phenylacetonitrile | |
SMILES | c1ccc(cc1)[C@H](C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 295.105589 (neutral) |
Table of KEGG reactions in human pathways involving Prunasin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02558 | Prunasin + H2O <=> Mandelonitrile + D-Glucose | (R)-Prunasin beta-D-glucohydrolase |
R02985 | Prunasin + D-Glucose <=> Amygdalin + H2O | amygdalin beta-glucosidase |
R10638 | Mandelonitrile + UDP-glucose <=> Prunasin + UDP | UDP-D-glucose:(R)-mandelonitrile beta-D-glucosyltransferase |
Table of KEGG human pathways containing Prunasin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 3 |