RefMet Compound Details
MW structure | 37725 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Pyridoxine 5'-phosphate | |
Systematic name | {[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methoxy}phosphonic acid | |
SMILES | Cc1c(c(CO)c(cn1)COP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 249.040227 (neutral) |
Table of KEGG reactions in human pathways involving Pyridoxine 5''-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01909 | ATP + Pyridoxine <=> ADP + Pyridoxine phosphate | ATP:pyridoxine 5'-phosphotransferase |
R00278 | Pyridoxine phosphate + Oxygen <=> Hydrogen peroxide + Pyridoxal phosphate | pyridoxine 5-phosphate:oxygen oxidoreductase |
R01911 | Pyridoxine + Orthophosphate <=> Pyridoxine phosphate + H2O | pyridoxine-5'-phosphate phosphohydrolase |
Table of KEGG human pathways containing Pyridoxine 5''-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00750 | Vitamin B6 metabolism | 3 |