RefMet Compound Details
RefMet ID | RM0135167 | |
---|---|---|
MW structure | 23089 (View MW Metabolite Database details) | |
RefMet name | Quercetin | |
Systematic name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one | |
SMILES | c1cc(c(cc1c1c(c(=O)c2c(cc(cc2o1)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 302.042655 (neutral) |
Table of KEGG reactions in human pathways involving Quercetin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02158 | UDP-glucose + Quercetin <=> UDP + Isoquercitrin | UDPglucose:flavonol 3-O-D-glucosyltransferase |
R13065 | Isoquercitrin + H2O <=> Quercetin + beta-D-Glucose | quercetin 3-O-glucoside glucohydrolase |
Table of KEGG human pathways containing Quercetin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 2 |