RefMet Compound Details

Created with Raphaƫl 2.1.0OHO
RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0135419
RefMet nameRetinoic acid
Systematic name3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2E,4E,6E,8E-tetraenoic acid
SynonymsPubChem Synonyms
Exact mass300.208930 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC20H28O2View other entries in RefMet with this formula
Molecular descriptors
Molfile29042 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12
-11+,15-8+,16-14+
InChIKeySHGAZHPCJJPHSC-YCNIQYBTSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESC/C(=C\C=C\C(=C\C(=O)O)\C)/C=C/C1=C(C)CCCC1(C)C
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassPrenol Lipids
Main ClassIsoprenoids
Sub ClassRetinoids
Distribution of Retinoic acid in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Retinoic acid
External Links
Pubchem CID444795
LIPID MAPSLMPR01090019
ChEBI ID15367
KEGG IDC00777
HMDB IDHMDB0001852
Chemspider ID392618
EPA CompToxDTXCID001239
Spectral data for Retinoic acid standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Retinoic acid

Rxn IDKEGG ReactionEnzyme
R02123 Retinal + NAD+ + H2O <=> Retinoate + NADH + H+retinal:NAD+ oxidoreductase
R02125 Retinal + Oxygen + H2O <=> Retinoate + Hydrogen peroxideretinal:oxygen oxidoreductase
R02902 Retinoate + UDP-glucuronate <=> all-trans-Retinoyl-beta-glucuronide + UDPRetinoate + UDP-glucuronate <=> all-trans-Retinoyl-beta-glucuronide + UDP
R08390 Retinoate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> all-trans-18-Hydroxyretinoic acid + [Oxidized NADPH---hemoprotein reductase] + H2ORetinoate + [Reduced NADPH---hemoprotein reductase] + Oxygen <=> all-trans-18-Hydroxyretinoic acid + [Oxidized NADPH---hemoprotein reductase] + H2O
R08391 Retinoate + NADPH + H+ + Oxygen <=> all-trans-5,6-Epoxyretinoic acid + NADP+ + H2ORetinoate + NADPH + H+ + Oxygen <=> all-trans-5,6-Epoxyretinoic acid + NADP+ + H2O
R08392 Retinoate + NADPH + H+ + Oxygen <=> all-trans-4-Hydroxyretinoic acid + NADP+ + H2ORetinoate + NADPH + H+ + Oxygen <=> all-trans-4-Hydroxyretinoic acid + NADP+ + H2O

Table of KEGG human pathways containing Retinoic acid

Pathway IDHuman Pathway# of reactions
hsa00830 Retinol metabolism 6
  logo