RefMet Compound Details
RefMet ID | RM0118499 | |
---|---|---|
MW structure | 40895 (View MW Metabolite Database details) | |
RefMet name | Retinyl beta-glucuronide | |
Systematic name | (2S,3S,4S,5R,6R)-6-{[(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid | |
SMILES | C/C(=C/C=C/C(=CCO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O)/C)/C=C/C1=C(C)CCCC1(C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 462.261754 (neutral) |
Table of KEGG reactions in human pathways involving Retinyl beta-glucuronide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01383 | UDP-glucuronate + ROH <=> UDP + beta-D-Glucuronoside | UDPglucuronate beta-D-glucuronosyltransferase (acceptor-unspecific) |
R01478 | H2O + beta-D-Glucuronoside <=> D-Glucuronate + Alcohol | beta-D-glucuronoside glucuronosohydrolase |
Table of KEGG human pathways containing Retinyl beta-glucuronide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 2 |