RefMet Compound Details
RefMet ID | RM0060431 | |
---|---|---|
MW structure | 93207 (View MW Metabolite Database details) | |
RefMet name | SM 14:1;O2/10:0 | |
Alternative name | SM(d14:1/10:0) | |
Systematic name | N-(decanoyl)-4E-tetradecasphingenine-1-phosphocholine | |
SMILES | CCCCCCCCC/C=C/[C@H]([C@H](COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCCCC)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | SM 24:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 562.411076 (neutral) |
Table of KEGG reactions in human pathways involving SM 14:1;O2/10:0
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01891 | CDP-choline + N-Acylsphingosine <=> CMP + Sphingomyelin | CDP-choline:N-acylsphingosine cholinephosphotransferase |
R02541 | Sphingomyelin + H2O <=> N-Acylsphingosine + Choline phosphate | Sphingomyelin cholinephosphohydrolase |
R08969 | N-Acylsphingosine + Phosphatidylcholine <=> Sphingomyelin + 1,2-Diacyl-sn-glycerol | ceramide:phosphatidylcholine cholinephosphotransferase |
Table of KEGG human pathways containing SM 14:1;O2/10:0
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00600 | Sphingolipid metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |