RefMet Compound Details

RefMet IDRM0042980
MW structure37177 (View MW Metabolite Database details)
RefMet nameSaccharopine
Systematic name(2S)-2-{[(5S)-5-amino-5-carboxypentyl]amino}pentanedioic acid
SMILESC(CCN[C@@H](CCC(=O)O)C(=O)O)C[C@@H](C(=O)O)N   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass276.132138 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC11H20N2O6View other entries in RefMet with this formula
InChIInChI=1S/C11H20N2O6/c12-7(10(16)17)3-1-2-6-13-8(11(18)19)4-5-9(14)15/h7-8,13H,1-6,12H2,(H,14,15)(H,16,17)(H,18,19)/t7-,8-/m0/s1
InChIKeyZDGJAHTZVHVLOT-YUMQZZPRSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Pubchem CID160556
ChEBI ID16927
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Saccharopine

Rxn IDKEGG ReactionEnzyme
R00715 N6-(L-1,3-Dicarboxypropyl)-L-lysine + NAD+ + H2O <=> L-Lysine + 2-Oxoglutarate + NADH + H+N6-(L-1,3-Dicarboxypropyl)-L-lysine:NAD+ oxidoreductase (L-lysine-forming)
R00716 N6-(L-1,3-Dicarboxypropyl)-L-lysine + NADP+ + H2O <=> L-Lysine + 2-Oxoglutarate + NADPH + H+N6-(L-1,3-Dicarboxypropyl)-L-lysine:NADP+ oxidoreductase (L-lysine-forming)
R02313 N6-(L-1,3-Dicarboxypropyl)-L-lysine + NAD+ + H2O <=> L-Glutamate + L-2-Aminoadipate 6-semialdehyde + NADH + H+N6-(L-1,3-Dicarboxypropyl)-L-lysine:NAD+ oxidoreductase
R02315 N6-(L-1,3-Dicarboxypropyl)-L-lysine + NADP+ + H2O <=> L-Glutamate + L-2-Aminoadipate 6-semialdehyde + NADPH + H+N6-(L-1,3-Dicarboxypropyl)-L-lysine:NADP+ oxidoreductase

Table of KEGG human pathways containing Saccharopine

Pathway IDHuman Pathway# of reactions
hsa00310 Lysine degradation 2
hsa01100 Metabolic pathways 2
  logo