RefMet Compound Details

RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0135925
RefMet nameSarcosine
Systematic name2-(methylamino)acetic acid
SynonymsPubChem Synonyms
Exact mass89.047679 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC3H7NO2View other entries in RefMet with this formula
Molecular descriptors
Molfile37173 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C3H7NO2/c1-4-2-3(5)6/h4H,2H2,1H3,(H,5,6)
InChIKeyFSYKKLYZXJSNPZ-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESCNCC(=O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Distribution of Sarcosine in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Sarcosine
External Links
Pubchem CID1088
ChEBI ID15611
KEGG IDC00213
HMDB IDHMDB0000271
Chemspider ID1057
MetaCyc IDSARCOSINE
Spectral data for Sarcosine standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Sarcosine

Rxn IDKEGG ReactionEnzyme
R00367 S-Adenosyl-L-methionine + Glycine <=> S-Adenosyl-L-homocysteine + SarcosineS-Adenosyl-L-methionine:glycine N-methyltransferase
R00610 Sarcosine + H2O + Oxygen <=> Glycine + Formaldehyde + Hydrogen peroxidesarcosine:oxygen oxidoreductase (demethylating)
R00611 Sarcosine + Electron-transferring flavoprotein + H2O <=> Glycine + Formaldehyde + Reduced electron-transferring flavoproteinsarcosine:electron-transfer flavoprotein oxidoreductase (demethylating)
R01564 N,N-Dimethylglycine + H2O + Oxygen <=> Sarcosine + Formaldehyde + Hydrogen peroxideN,N-Dimethylglycine:oxygen oxidoreductase (demethylating)
R01565 N,N-Dimethylglycine + Tetrahydrofolate + Electron-transferring flavoprotein <=> Sarcosine + 5,10-Methylenetetrahydrofolate + Reduced electron-transferring flavoproteinN,N-dimethylglycine,5,6,7,8-tetrahydrofolate:electron-transferflavoprotein oxidoreductase (demethylating,5,10-methylenetetrahydrofolate-forming)
R12967 Sarcosine + Tetrahydrofolate + Oxygen <=> Glycine + 5,10-Methylenetetrahydrofolate + Hydrogen peroxidesarcosine, 5,6,7,8-tetrahydrofolate:O2 oxidoreductase (demethylating,5,10-methylenetetrahydrofolate-forming)
R13028 N,N-Dimethylglycine + 2 Oxidized ferredoxin + H2O <=> Sarcosine + Formaldehyde + 2 Reduced ferredoxin + 2 H+N,N-dimethylglycine:ferredoxin oxidoreductase (demethylating)
R13029 Sarcosine + 2 Oxidized ferredoxin + H2O <=> Glycine + Formaldehyde + 2 Reduced ferredoxin + 2 H+sarcosine:ferredoxin oxidoreductase (demethylating)

Table of KEGG human pathways containing Sarcosine

Pathway IDHuman Pathway# of reactions
hsa00260 Glycine, serine and threonine metabolism 4
hsa01100 Metabolic pathways 4
  logo