RefMet Compound Details
RefMet ID | RM0136852 | |
---|---|---|
MW structure | 51108 (View MW Metabolite Database details) | |
RefMet name | Sedoheptulose 1,7-bisphosphate | |
Systematic name | D-altro-hept-2-ulose 1,7-bis(dihydrogen phosphate) | |
SMILES | C([C@H]([C@H]([C@H]([C@@H](C(=O)COP(=O)(O)O)O)O)O)O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 370.006621 (neutral) |
Table of KEGG reactions in human pathways involving Sedoheptulose 1,7-bisphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01829 | Sedoheptulose 1,7-bisphosphate <=> Glycerone phosphate + D-Erythrose 4-phosphate | sedoheptulose 1,7-bisphosphate D-glyceraldehyde-3-phosphate-lyase |
Table of KEGG human pathways containing Sedoheptulose 1,7-bisphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01200 | Carbon metabolism | 1 |