RefMet Compound Details
RefMet ID | RM0013134 | |
---|---|---|
MW structure | 51447 (View MW Metabolite Database details) | |
RefMet name | Selenocystathionine | |
Systematic name | (2S)-2-amino-4-{[(2R)-2-amino-2-carboxyethyl]selanyl}butanoic acid | |
SMILES | C(C[Se]C[C@@H](C(=O)O)N)[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 270.011879 (neutral) |
Table of KEGG reactions in human pathways involving Selenocystathionine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04941 | L-Selenocystathionine + H2O <=> Selenohomocysteine + Ammonia + Pyruvate | Selenocystathionine L-homocysteine-lyase (deaminating) |
Table of KEGG human pathways containing Selenocystathionine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00450 | Selenocompound metabolism | 1 |