RefMet Compound Details

RefMet ID	RM0032433
MW structure	37123 (View MW Metabolite Database details)
RefMet name	Serine
Systematic name	(2S)-2-amino-3-hydroxypropanoic acid
SMILES	C([C@@H](C(=O)O)N)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Exact mass	105.042594 (neutral)	Calculate m/z: (Choose adduct) [M+H]+ [M+H-H2O]+ [M.]+ [M+2H]2+ [M+3H]3+ [M+4H]4+ [M+K]+ [M+2K]2+ [M+2K-H]+ [M+Na]+ [M+2Na]2+ [M+2Na-H]+ [M+Li]+ [M+2Li]2+ [M+NH4]+ [M.CH3]+ [M+Ag]+ [M+H+CH3OH]+ [M+H+CH3CN]+ [M+H+2CH3CN]+ [M+Na+CH3CN]+ [M.NaFormate+H]+ [M.NH4Formate+H]+ [M.TMSi]+ [M.tBuDMSi]+ [M+H-Hexose]+ [M+H-EtnP]+ [M+H-SerP]+ [M-H]- [M-H-H2O]- [M-CH3]- [M-2H]2- [M-3H]3- [M-4H]4- [M+Cl]- [M+OAc]- [M+Na-2H]- [M+K-2H]- [M.Formate]- [M.NaFormate-H]- [M.NH4Formate-H]- [M.F]- [M-H-Ser]- [M.HF2]- M(neutral)    View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
Formula	C3H7NO3	View other entries in RefMet with this formula
InChI	InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1
InChIKey	MTCFGRXMJLQNBG-REOHCLBHSA-N	View other enantiomers/diastereomers of this metabolite in RefMet
Super Class	Organic acids
Main Class	Amino acids and peptides
Sub Class	Amino acids
Pubchem CID	5951
ChEBI ID	17115
Annotation level	1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Serine

Rxn ID	KEGG Reaction	Enzyme
R00220	L-Serine <=> Pyruvate + Ammonia	L-serine ammonia-lyase
R00582	O-Phospho-L-serine + H2O <=> L-Serine + Orthophosphate	O-phospho-L-serine phosphohydrolase
R00585	L-Serine + Pyruvate <=> Hydroxypyruvate + L-Alanine	L-Serine:pyruvate aminotransferase
R00588	L-Serine + Glyoxylate <=> Hydroxypyruvate + Glycine	L-Serine:glyoxylate aminotransferase
R00589	L-Serine <=> D-Serine	serine racemase
R00590	L-Serine <=> Dehydroalanine + H2O	L-serine hydro-lyase
R00891	L-Serine + Hydrogen sulfide <=> L-Cysteine + H2O	L-serine hydro-lyase (adding hydrogen sulfide, L-cysteine-forming)
R00945	5,10-Methylenetetrahydrofolate + Glycine + H2O <=> Tetrahydrofolate + L-Serine	5,10-Methylenetetrahydrofolate:glycine hydroxymethyltransferase
R01290	L-Serine + L-Homocysteine <=> L-Cystathionine + H2O	L-serine hydro-lyase (adding homocysteine
R03662	ATP + L-Serine + tRNA(Ser) <=> AMP + Diphosphate + L-Seryl-tRNA(Ser)	L-Serine:tRNA(Ser) ligase (AMP-forming)
R08218	ATP + L-Serine + tRNA(Sec) <=> AMP + Diphosphate + L-Seryl-tRNA(Sec)	L-serine:tRNASec ligase (AMP-forming)
R09099	L-Serine + 5,6,7,8-Tetrahydromethanopterin <=> 5,10-Methylenetetrahydromethanopterin + Glycine + H2O	5,10-methylenetetrahydromethanopterin:glycine hydroxymethyltransferase
R12342	ADP + L-Serine <=> AMP + O-Phospho-L-serine	ADP:L-serine 3-phosphotransferase
R12344	ATP + L-Serine <=> ADP + O-Phospho-L-serine	ATP:L-serine 3-phosphotransferase

Table of KEGG human pathways containing Serine

Pathway ID	Human Pathway	# of reactions
hsa00260	Glycine, serine and threonine metabolism	8
hsa01230	Biosynthesis of amino acids	4
hsa01200	Carbon metabolism	4
hsa01100	Metabolic pathways	3
hsa00630	Glyoxylate and dicarboxylate metabolism	2
hsa00970	Aminoacyl-tRNA biosynthesis	2
hsa00270	Cysteine and methionine metabolism	2
hsa00670	One carbon pool by folate	1
hsa00600	Sphingolipid metabolism	1