RefMet Compound Details
RefMet ID | RM0160568 | |
---|---|---|
MW structure | 38360 (View MW Metabolite Database details) | |
RefMet name | Stachyose | |
Systematic name | O-alpha-D-galactopyranosyl-(1->6)o-alpha-D-galactopyranosyl-(1->6)O-alpha-D-galactopyranosyl-beta-D-fructofuranoside | |
SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](OC[C@@H]2[C@@H]([C@@H]([C@H]([C@@H](OC[C@@H]3[C@H]([C@@H]([C@H]([C@H](O3)O[C@@]3(CO)[C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O)O2)O)O)O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 666.221865 (neutral) |
Table of KEGG reactions in human pathways involving Stachyose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03418 | alpha-D-Galactosyl-(1->3)-1D-myo-inositol + Raffinose <=> myo-Inositol + Stachyose | 1-alpha-D-Galactosyl-myo-inositol:raffinose galactosyltransferase |
R03634 | Stachyose + H2O <=> Raffinose + D-Galactose | Stachyose + H2O <=> Raffinose + D-Galactose |
Table of KEGG human pathways containing Stachyose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |